C10H19NO2S — CID 103767793
N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylbut-2-enamide (PubChem CID 103767793) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylbut-2-enamide.
| Compound Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 103767793 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[2-(3-hydroxypropylsulfanyl)ethyl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)NCCSCCCO |
| InChI | InChI=1S/C10H19NO2S/c1-9(2)8-10(13)11-4-7-14-6-3-5-12/h8,12H,3-7H2,1-2H3,(H,11,13) |
| InChIKey | GELPOBBOKKYBGK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|