C12H19NO4 — CID 10377036
(1,1-dimethoxyethylamino)-(4-methoxyphenyl)methanol (PubChem CID 10377036) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is (1,1-dimethoxyethylamino)-(4-methoxyphenyl)methanol.
| Compound Name | (1,1-dimethoxyethylamino)-(4-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 10377036 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (1,1-dimethoxyethylamino)-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)NC(C)(OC)OC)cc1 |
| InChI | InChI=1S/C12H19NO4/c1-12(16-3,17-4)13-11(14)9-5-7-10(15-2)8-6-9/h5-8,11,13-14H,1-4H3 |
| InChIKey | MOKBSBLDCAXXFW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|