About (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate
(4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate (PubChem CID 139244940) has the molecular formula C8H14O5Ti3+6
and a molecular weight of 333.80 g/mol. Its IUPAC name is (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate |
| PubChem CID | 139244940 |
| Molecular Formula | C8H14O5Ti3+6 |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.92 |
| IUPAC Name | (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate |
| SMILES | COc1ccc(C(O)O)cc1.O.O.[Ti+3].[Ti+3].[Ti] |
| InChI | InChI=1S/C8H10O3.2H2O.3Ti/c1-11-7-4-2-6(3-5-7)8(9)10;;;;;/h2-5,8-10H,1H3;2*1H2;;;/q;;;;2*+3 |
| InChIKey | NGXYTNNXSMKHQY-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 112.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate?
The IUPAC name of (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate (CID 139244940) is (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate.
What is the SMILES notation for (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate?
The canonical SMILES for (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate is COc1ccc(C(O)O)cc1.O.O.[Ti+3].[Ti+3].[Ti].
What is the InChIKey of (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate?
The InChIKey is NGXYTNNXSMKHQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3.2H2O.3Ti/c1-11-7-4-2-6(3-5-7)8(9)10;;;;;/h2-5,8-10H,1H3;2*1H2;;;/q;;;;2*+3.
What are the key properties of (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate?
(4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate has a molecular weight of 333.80 g/mol, XLogP of -0.98, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methanediol;titanium;bis(titanium(3+));dihydrate is sourced from PubChem (CID 139244940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).