C9H9NO2Se — CID 10377058
6-(1-hydroxyethyl)-3H-1,3-benzoselenazol-2-one (PubChem CID 10377058) has the molecular formula C9H9NO2Se and a molecular weight of 242.14 g/mol. Its IUPAC name is 6-(1-hydroxyethyl)-3H-1,3-benzoselenazol-2-one.
| Compound Name | 6-(1-hydroxyethyl)-3H-1,3-benzoselenazol-2-one |
|---|---|
| PubChem CID | 10377058 |
| Molecular Formula | C9H9NO2Se |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | 6-(1-hydroxyethyl)-3H-1,3-benzoselenazol-2-one |
| SMILES | CC(O)c1ccc2[nH]c(=O)[se]c2c1 |
| InChI | InChI=1S/C9H9NO2Se/c1-5(11)6-2-3-7-8(4-6)13-9(12)10-7/h2-5,11H,1H3,(H,10,12) |
| InChIKey | GBQKSLHQEUCTQP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|