C14H12N4O2 — CID 103772000
N-(1H-indazol-4-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103772000) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-(1H-indazol-4-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-(1H-indazol-4-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103772000 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | N-(1H-indazol-4-yl)-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cccc3[nH]ncc23)c[nH]1 |
| InChI | InChI=1S/C14H12N4O2/c1-8-5-13(19)10(6-15-8)14(20)17-11-3-2-4-12-9(11)7-16-18-12/h2-7H,1H3,(H,15,19)(H,16,18)(H,17,20) |
| InChIKey | GTMFKSDIHVJVIC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |