C14H16N4O2 — CID 103717969
N-[4-(dimethylamino)-3-pyridinyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 103717969) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is N-[4-(dimethylamino)-3-pyridinyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[4-(dimethylamino)-3-pyridinyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103717969 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N-[4-(dimethylamino)-3-pyridinyl]-6-methyl-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cnccc2N(C)C)c[nH]1 |
| InChI | InChI=1S/C14H16N4O2/c1-9-6-13(19)10(7-16-9)14(20)17-11-8-15-5-4-12(11)18(2)3/h4-8H,1-3H3,(H,16,19)(H,17,20) |
| InChIKey | NHXFFHZXWLGWCU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |