C14H13Br2N3O — CID 103885438
2,4-dibromo-N-[4-(dimethylamino)-3-pyridinyl]benzamide (PubChem CID 103885438) has the molecular formula C14H13Br2N3O and a molecular weight of 399.09 g/mol. Its IUPAC name is 2,4-dibromo-N-[4-(dimethylamino)-3-pyridinyl]benzamide.
| Compound Name | 2,4-dibromo-N-[4-(dimethylamino)-3-pyridinyl]benzamide |
|---|---|
| PubChem CID | 103885438 |
| Molecular Formula | C14H13Br2N3O |
| Molecular Weight | 399.09 g/mol |
| Exact Mass | 396.94 |
| IUPAC Name | 2,4-dibromo-N-[4-(dimethylamino)-3-pyridinyl]benzamide |
| SMILES | CN(C)c1ccncc1NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H13Br2N3O/c1-19(2)13-5-6-17-8-12(13)18-14(20)10-4-3-9(15)7-11(10)16/h3-8H,1-2H3,(H,18,20) |
| InChIKey | MWXYQCWNNPRRAK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |