C13H23NO2 — CID 103772445
N-(4-hydroxy-2,2-dimethylbutyl)cyclohex-3-ene-1-carboxamide (PubChem CID 103772445) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)cyclohex-3-ene-1-carboxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 103772445 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)cyclohex-3-ene-1-carboxamide |
| SMILES | CC(C)(CCO)CNC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,8-9-15)10-14-12(16)11-6-4-3-5-7-11/h3-4,11,15H,5-10H2,1-2H3,(H,14,16) |
| InChIKey | DOXWPOBMEXSRSS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|