C16H19F2NO2 — CID 111335363
N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]cyclohex-3-ene-1-carboxamide (PubChem CID 111335363) has the molecular formula C16H19F2NO2 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 111335363 |
| Molecular Formula | C16H19F2NO2 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]cyclohex-3-ene-1-carboxamide |
| SMILES | CC(O)(CNC(=O)C1CC=CCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H19F2NO2/c1-16(21,13-8-7-12(17)9-14(13)18)10-19-15(20)11-5-3-2-4-6-11/h2-3,7-9,11,21H,4-6,10H2,1H3,(H,19,20) |
| InChIKey | XHDWUETWDYTYPG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|