C13H17F2NO2 — CID 111335414
N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-methylpropanamide (PubChem CID 111335414) has the molecular formula C13H17F2NO2 and a molecular weight of 257.28 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-methylpropanamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 111335414 |
| Molecular Formula | C13H17F2NO2 |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H17F2NO2/c1-8(2)12(17)16-7-13(3,18)10-5-4-9(14)6-11(10)15/h4-6,8,18H,7H2,1-3H3,(H,16,17) |
| InChIKey | ISZYXVSUYAUSQZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |