C14H19F2NO2S — CID 111335334
N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-propylsulfanylacetamide (PubChem CID 111335334) has the molecular formula C14H19F2NO2S and a molecular weight of 303.37 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-propylsulfanylacetamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-propylsulfanylacetamide |
|---|---|
| PubChem CID | 111335334 |
| Molecular Formula | C14H19F2NO2S |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-2-propylsulfanylacetamide |
| SMILES | CCCSCC(=O)NCC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C14H19F2NO2S/c1-3-6-20-8-13(18)17-9-14(2,19)11-5-4-10(15)7-12(11)16/h4-5,7,19H,3,6,8-9H2,1-2H3,(H,17,18) |
| InChIKey | KAJLNVUMLAQDGL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|