C15H17F2NO3 — CID 109476951
N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-prop-2-ynoxypropanamide (PubChem CID 109476951) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-prop-2-ynoxypropanamide.
| Compound Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-prop-2-ynoxypropanamide |
|---|---|
| PubChem CID | 109476951 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)-2-hydroxypropyl]-3-prop-2-ynoxypropanamide |
| SMILES | C#CCOCCC(=O)NCC(C)(O)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H17F2NO3/c1-3-7-21-8-6-14(19)18-10-15(2,20)12-5-4-11(16)9-13(12)17/h1,4-5,9,20H,6-8,10H2,2H3,(H,18,19) |
| InChIKey | HIYCEJXNZASAFR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|