C8H12N2O2S — CID 103775079
N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 103775079) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 103775079 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | N-[(2-oxo-3H-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | CCCC(=O)NCc1csc(=O)[nH]1 |
| InChI | InChI=1S/C8H12N2O2S/c1-2-3-7(11)9-4-6-5-13-8(12)10-6/h5H,2-4H2,1H3,(H,9,11)(H,10,12) |
| InChIKey | VRGUTHPRGNHQTJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |