C7H10N2O2S — CID 123679448
2-oxo-N-propyl-3H-1,3-thiazole-4-carboxamide (PubChem CID 123679448) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-oxo-N-propyl-3H-1,3-thiazole-4-carboxamide.
| Compound Name | 2-oxo-N-propyl-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123679448 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-oxo-N-propyl-3H-1,3-thiazole-4-carboxamide |
| SMILES | CCCNC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-3-8-6(10)5-4-12-7(11)9-5/h4H,2-3H2,1H3,(H,8,10)(H,9,11) |
| InChIKey | IABDRRIFKIAZFU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |