About N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide
N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide (PubChem CID 123193062) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
| PubChem CID | 123193062 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C5H6N2O2S/c1-6-4(8)3-2-10-5(9)7-3/h2H,1H3,(H,6,8)(H,7,9) |
| InChIKey | JGNFYXRIKACWHI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide?
The IUPAC name of N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide (CID 123193062) is N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide is CNC(=O)c1csc(=O)[nH]1.
What is the InChIKey of N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide?
The InChIKey is JGNFYXRIKACWHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-6-4(8)3-2-10-5(9)7-3/h2H,1H3,(H,6,8)(H,7,9).
What are the key properties of N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide?
N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide has a molecular weight of 158.18 g/mol, XLogP of -0.20, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 123193062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).