C5H6N2O2S — CID 123193062
N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide (PubChem CID 123193062) has the molecular formula C5H6N2O2S and a molecular weight of 158.18 g/mol. Its IUPAC name is N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide.
| Compound Name | N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123193062 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | N-methyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
| SMILES | CNC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C5H6N2O2S/c1-6-4(8)3-2-10-5(9)7-3/h2H,1H3,(H,6,8)(H,7,9) |
| InChIKey | JGNFYXRIKACWHI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |