C6H8N2O2S — CID 123394572
N-ethyl-2-oxo-3H-1,3-thiazole-4-carboxamide (PubChem CID 123394572) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is N-ethyl-2-oxo-3H-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123394572 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | N-ethyl-2-oxo-3H-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(=O)[nH]1 |
| InChI | InChI=1S/C6H8N2O2S/c1-2-7-5(9)4-3-11-6(10)8-4/h3H,2H2,1H3,(H,7,9)(H,8,10) |
| InChIKey | QAUWDUIEWJTJEX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |