C14H24N2O2S2 — CID 103776584
N-[3-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]propyl]methanesulfonamide (PubChem CID 103776584) has the molecular formula C14H24N2O2S2 and a molecular weight of 316.49 g/mol. Its IUPAC name is N-[3-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]propyl]methanesulfonamide.
| Compound Name | N-[3-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 103776584 |
| Molecular Formula | C14H24N2O2S2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N-[3-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]propyl]methanesulfonamide |
| SMILES | CC(NCCCNS(C)(=O)=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H24N2O2S2/c1-11(15-8-5-9-16-20(2,17)18)14-10-12-6-3-4-7-13(12)19-14/h10-11,15-16H,3-9H2,1-2H3 |
| InChIKey | OMAHAFHIDPJUEA-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|