C15H25NOS2 — CID 103781932
3-[2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]ethylsulfanyl]propan-1-ol (PubChem CID 103781932) has the molecular formula C15H25NOS2 and a molecular weight of 299.51 g/mol. Its IUPAC name is 3-[2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 103781932 |
| Molecular Formula | C15H25NOS2 |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[2-[1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethylamino]ethylsulfanyl]propan-1-ol |
| SMILES | CC(NCCSCCCO)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C15H25NOS2/c1-12(16-7-10-18-9-4-8-17)15-11-13-5-2-3-6-14(13)19-15/h11-12,16-17H,2-10H2,1H3 |
| InChIKey | ZTPGUEJNJVCIAK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|