C14H23NO2 — CID 103776783
1-(furan-2-yl)-N-[1-(oxan-4-yl)ethyl]propan-2-amine (PubChem CID 103776783) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-(furan-2-yl)-N-[1-(oxan-4-yl)ethyl]propan-2-amine.
| Compound Name | 1-(furan-2-yl)-N-[1-(oxan-4-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 103776783 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-(furan-2-yl)-N-[1-(oxan-4-yl)ethyl]propan-2-amine |
| SMILES | CC(Cc1ccco1)NC(C)C1CCOCC1 |
| InChI | InChI=1S/C14H23NO2/c1-11(10-14-4-3-7-17-14)15-12(2)13-5-8-16-9-6-13/h3-4,7,11-13,15H,5-6,8-10H2,1-2H3 |
| InChIKey | IDZHATZOCFNXSW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |