C13H22N2O — CID 63086190
4-N-[1-(furan-2-yl)propan-2-yl]cyclohexane-1,4-diamine (PubChem CID 63086190) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 4-N-[1-(furan-2-yl)propan-2-yl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[1-(furan-2-yl)propan-2-yl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 63086190 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 4-N-[1-(furan-2-yl)propan-2-yl]cyclohexane-1,4-diamine |
| SMILES | CC(Cc1ccco1)NC1CCC(N)CC1 |
| InChI | InChI=1S/C13H22N2O/c1-10(9-13-3-2-8-16-13)15-12-6-4-11(14)5-7-12/h2-3,8,10-12,15H,4-7,9,14H2,1H3 |
| InChIKey | DRWFSIIKTXMHEJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |