C16H22BrFN2O — CID 103777824
3-[1-(2-bromo-4-fluorophenyl)ethylamino]-1-piperidin-1-ylpropan-1-one (PubChem CID 103777824) has the molecular formula C16H22BrFN2O and a molecular weight of 357.27 g/mol. Its IUPAC name is 3-[1-(2-bromo-4-fluorophenyl)ethylamino]-1-piperidin-1-ylpropan-1-one.
| Compound Name | 3-[1-(2-bromo-4-fluorophenyl)ethylamino]-1-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 103777824 |
| Molecular Formula | C16H22BrFN2O |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 3-[1-(2-bromo-4-fluorophenyl)ethylamino]-1-piperidin-1-ylpropan-1-one |
| SMILES | CC(NCCC(=O)N1CCCCC1)c1ccc(F)cc1Br |
| InChI | InChI=1S/C16H22BrFN2O/c1-12(14-6-5-13(18)11-15(14)17)19-8-7-16(21)20-9-3-2-4-10-20/h5-6,11-12,19H,2-4,7-10H2,1H3 |
| InChIKey | PMNFASKJDZYQOZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |