C14H20F3NO2S — CID 103778096
1-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]propan-1-amine (PubChem CID 103778096) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]propan-1-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 103778096 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-[2-(trifluoromethylsulfanyl)ethyl]propan-1-amine |
| SMILES | CCC(NCCSC(F)(F)F)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20F3NO2S/c1-4-11(18-7-8-21-14(15,16)17)10-5-6-12(19-2)13(9-10)20-3/h5-6,9,11,18H,4,7-8H2,1-3H3 |
| InChIKey | JTVUDZHCJMVNNV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|