C15H24F3N3O2 — CID 147773142
(1S,3R)-1-(3,4-dimethoxyphenyl)-N-ethyl-4,4,4-trifluoro-3-(2-methylhydrazinyl)butan-1-amine (PubChem CID 147773142) has the molecular formula C15H24F3N3O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is (1S,3R)-1-(3,4-dimethoxyphenyl)-N-ethyl-4,4,4-trifluoro-3-(2-methylhydrazinyl)butan-1-amine.
| Compound Name | (1S,3R)-1-(3,4-dimethoxyphenyl)-N-ethyl-4,4,4-trifluoro-3-(2-methylhydrazinyl)butan-1-amine |
|---|---|
| PubChem CID | 147773142 |
| Molecular Formula | C15H24F3N3O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | (1S,3R)-1-(3,4-dimethoxyphenyl)-N-ethyl-4,4,4-trifluoro-3-(2-methylhydrazinyl)butan-1-amine |
| SMILES | CCN[C@@H](C[C@@H](NNC)C(F)(F)F)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H24F3N3O2/c1-5-20-11(9-14(21-19-2)15(16,17)18)10-6-7-12(22-3)13(8-10)23-4/h6-8,11,14,19-21H,5,9H2,1-4H3/t11-,14+/m0/s1 |
| InChIKey | HGHZUKFCMOWINA-SMDDNHRTSA-N |
| XLogP | 2.40 |
| TPSA | 54.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|