C16H27NO2S — CID 64609867
2-butylsulfanyl-1-(3,4-dimethoxyphenyl)-N-ethylethanamine (PubChem CID 64609867) has the molecular formula C16H27NO2S and a molecular weight of 297.46 g/mol. Its IUPAC name is 2-butylsulfanyl-1-(3,4-dimethoxyphenyl)-N-ethylethanamine.
| Compound Name | 2-butylsulfanyl-1-(3,4-dimethoxyphenyl)-N-ethylethanamine |
|---|---|
| PubChem CID | 64609867 |
| Molecular Formula | C16H27NO2S |
| Molecular Weight | 297.46 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 2-butylsulfanyl-1-(3,4-dimethoxyphenyl)-N-ethylethanamine |
| SMILES | CCCCSCC(NCC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H27NO2S/c1-5-7-10-20-12-14(17-6-2)13-8-9-15(18-3)16(11-13)19-4/h8-9,11,14,17H,5-7,10,12H2,1-4H3 |
| InChIKey | BSQRJNXRHUJOHE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|