C17H29NO2S — CID 107763149
1-(2,4-dimethoxyphenyl)-N-ethyl-2-pentylsulfanylethanamine (PubChem CID 107763149) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-N-ethyl-2-pentylsulfanylethanamine.
| Compound Name | 1-(2,4-dimethoxyphenyl)-N-ethyl-2-pentylsulfanylethanamine |
|---|---|
| PubChem CID | 107763149 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-N-ethyl-2-pentylsulfanylethanamine |
| SMILES | CCCCCSCC(NCC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C17H29NO2S/c1-5-7-8-11-21-13-16(18-6-2)15-10-9-14(19-3)12-17(15)20-4/h9-10,12,16,18H,5-8,11,13H2,1-4H3 |
| InChIKey | AJQFJQJGXKGAGH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|