C12H13ClF3NS — CID 103778130
5-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 103778130) has the molecular formula C12H13ClF3NS and a molecular weight of 295.76 g/mol. Its IUPAC name is 5-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | 5-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 103778130 |
| Molecular Formula | C12H13ClF3NS |
| Molecular Weight | 295.76 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 5-chloro-N-[2-(trifluoromethylsulfanyl)ethyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | FC(F)(F)SCCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H13ClF3NS/c13-10-2-1-8-6-11(7-9(8)5-10)17-3-4-18-12(14,15)16/h1-2,5,11,17H,3-4,6-7H2 |
| InChIKey | KZGYWFGWYGMFPJ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.76 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|