C13H24OS2 — CID 10377932
(2S,3R)-1-(1,3-dithian-2-ylidene)-2-methyloctan-3-ol (PubChem CID 10377932) has the molecular formula C13H24OS2 and a molecular weight of 260.47 g/mol. Its IUPAC name is (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methyloctan-3-ol.
| Compound Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methyloctan-3-ol |
|---|---|
| PubChem CID | 10377932 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | (2S,3R)-1-(1,3-dithian-2-ylidene)-2-methyloctan-3-ol |
| SMILES | CCCCC[C@@H](O)[C@@H](C)C=C1SCCCS1 |
| InChI | InChI=1S/C13H24OS2/c1-3-4-5-7-12(14)11(2)10-13-15-8-6-9-16-13/h10-12,14H,3-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | DUKKPKIZMOMICQ-NWDGAFQWSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|