C10H13ClN2O2S — CID 103780257
2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyridin-4-amine (PubChem CID 103780257) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyridin-4-amine.
| Compound Name | 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyridin-4-amine |
|---|---|
| PubChem CID | 103780257 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-chloro-N-[(1,1-dioxothiolan-2-yl)methyl]pyridin-4-amine |
| SMILES | O=S1(=O)CCCC1CNc1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O2S/c11-10-6-8(3-4-12-10)13-7-9-2-1-5-16(9,14)15/h3-4,6,9H,1-2,5,7H2,(H,12,13) |
| InChIKey | VRWRTMHWWRTSTH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|