C11H17N3O2S — CID 106751026
4-N-[(1,1-dioxothiolan-2-yl)methyl]benzene-1,2,4-triamine (PubChem CID 106751026) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 4-N-[(1,1-dioxothiolan-2-yl)methyl]benzene-1,2,4-triamine.
| Compound Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 106751026 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]benzene-1,2,4-triamine |
| SMILES | Nc1ccc(NCC2CCCS2(=O)=O)cc1N |
| InChI | InChI=1S/C11H17N3O2S/c12-10-4-3-8(6-11(10)13)14-7-9-2-1-5-17(9,15)16/h3-4,6,9,14H,1-2,5,7,12-13H2 |
| InChIKey | ZLZNMVNQULXVTM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|