C9H15N5O2S — CID 81046481
4-N-[(1,1-dioxothiolan-2-yl)methyl]pyrimidine-2,4,6-triamine (PubChem CID 81046481) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-N-[(1,1-dioxothiolan-2-yl)methyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 81046481 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-N-[(1,1-dioxothiolan-2-yl)methyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(NCC2CCCS2(=O)=O)nc(N)n1 |
| InChI | InChI=1S/C9H15N5O2S/c10-7-4-8(14-9(11)13-7)12-5-6-2-1-3-17(6,15)16/h4,6H,1-3,5H2,(H5,10,11,12,13,14) |
| InChIKey | JJYOFMXIZIPRMW-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 123.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |