C10H20F3NO — CID 103783163
2,3-dimethyl-1-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol (PubChem CID 103783163) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol.
| Compound Name | 2,3-dimethyl-1-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 103783163 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2,3-dimethyl-1-(4,4,4-trifluorobutan-2-ylamino)butan-2-ol |
| SMILES | CC(CC(F)(F)F)NCC(C)(O)C(C)C |
| InChI | InChI=1S/C10H20F3NO/c1-7(2)9(4,15)6-14-8(3)5-10(11,12)13/h7-8,14-15H,5-6H2,1-4H3 |
| InChIKey | SMMIORRSMPYHPH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |