C10H19N3OS — CID 103783659
4-(thiolan-3-ylamino)piperidine-1-carboxamide (PubChem CID 103783659) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 4-(thiolan-3-ylamino)piperidine-1-carboxamide.
| Compound Name | 4-(thiolan-3-ylamino)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 103783659 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-(thiolan-3-ylamino)piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NC2CCSC2)CC1 |
| InChI | InChI=1S/C10H19N3OS/c11-10(14)13-4-1-8(2-5-13)12-9-3-6-15-7-9/h8-9,12H,1-7H2,(H2,11,14) |
| InChIKey | ZLVPRZWUNFZVME-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |