C15H26N4O2 — CID 43791478
4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]amino]piperidine-1-carboxamide (PubChem CID 43791478) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]amino]piperidine-1-carboxamide.
| Compound Name | 4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 43791478 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 4-[[1-(cyclopropanecarbonyl)piperidin-4-yl]amino]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(NC2CCN(C(=O)C3CC3)CC2)CC1 |
| InChI | InChI=1S/C15H26N4O2/c16-15(21)19-9-5-13(6-10-19)17-12-3-7-18(8-4-12)14(20)11-1-2-11/h11-13,17H,1-10H2,(H2,16,21) |
| InChIKey | GJROZYIWGZZGLE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |