About [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol
[2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol (PubChem CID 103786074) has the molecular formula C14H19Br2NO
and a molecular weight of 377.12 g/mol. Its IUPAC name is [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol |
| PubChem CID | 103786074 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol |
| SMILES | CC(NC1CCCC1CO)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2NO/c1-9(12-6-5-11(15)7-13(12)16)17-14-4-2-3-10(14)8-18/h5-7,9-10,14,17-18H,2-4,8H2,1H3 |
| InChIKey | KWOIBIPFTMISKI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol?
The IUPAC name of [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol (CID 103786074) is [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol.
What is the SMILES notation for [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol?
The canonical SMILES for [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol is CC(NC1CCCC1CO)c1ccc(Br)cc1Br.
What is the InChIKey of [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol?
The InChIKey is KWOIBIPFTMISKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19Br2NO/c1-9(12-6-5-11(15)7-13(12)16)17-14-4-2-3-10(14)8-18/h5-7,9-10,14,17-18H,2-4,8H2,1H3.
What are the key properties of [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol?
[2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol has a molecular weight of 377.12 g/mol, XLogP of 4.02, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol is sourced from PubChem (CID 103786074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).