C14H19Br2NO — CID 103786074
[2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol (PubChem CID 103786074) has the molecular formula C14H19Br2NO and a molecular weight of 377.12 g/mol. Its IUPAC name is [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol.
| Compound Name | [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 103786074 |
| Molecular Formula | C14H19Br2NO |
| Molecular Weight | 377.12 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | [2-[1-(2,4-dibromophenyl)ethylamino]cyclopentyl]methanol |
| SMILES | CC(NC1CCCC1CO)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H19Br2NO/c1-9(12-6-5-11(15)7-13(12)16)17-14-4-2-3-10(14)8-18/h5-7,9-10,14,17-18H,2-4,8H2,1H3 |
| InChIKey | KWOIBIPFTMISKI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.12 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |