C17H27NO3 — CID 103786094
[2-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]cyclopentyl]methanol (PubChem CID 103786094) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [2-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]cyclopentyl]methanol.
| Compound Name | [2-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 103786094 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | [2-[1-(3,4-dimethoxyphenyl)propan-2-ylamino]cyclopentyl]methanol |
| SMILES | COc1ccc(CC(C)NC2CCCC2CO)cc1OC |
| InChI | InChI=1S/C17H27NO3/c1-12(18-15-6-4-5-14(15)11-19)9-13-7-8-16(20-2)17(10-13)21-3/h7-8,10,12,14-15,18-19H,4-6,9,11H2,1-3H3 |
| InChIKey | SQIJCQDOSKASGW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |