C17H26N2O3 — CID 42563386
(3R)-3-[[(2S)-1-(3,4-dimethoxyphenyl)propan-2-yl]amino]azepan-2-one (PubChem CID 42563386) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is (3R)-3-[[(2S)-1-(3,4-dimethoxyphenyl)propan-2-yl]amino]azepan-2-one.
| Compound Name | (3R)-3-[[(2S)-1-(3,4-dimethoxyphenyl)propan-2-yl]amino]azepan-2-one |
|---|---|
| PubChem CID | 42563386 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3R)-3-[[(2S)-1-(3,4-dimethoxyphenyl)propan-2-yl]amino]azepan-2-one |
| SMILES | COc1ccc(C[C@H](C)N[C@@H]2CCCCNC2=O)cc1OC |
| InChI | InChI=1S/C17H26N2O3/c1-12(19-14-6-4-5-9-18-17(14)20)10-13-7-8-15(21-2)16(11-13)22-3/h7-8,11-12,14,19H,4-6,9-10H2,1-3H3,(H,18,20)/t12-,14+/m0/s1 |
| InChIKey | XKHRVMPOWQWFPM-GXTWGEPZSA-N |
| XLogP | 1.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |