C17H25N3O4 — CID 94819772
2-(3,4-dimethoxy-N-methylanilino)-N-[(3S)-2-oxoazepan-3-yl]acetamide (PubChem CID 94819772) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxy-N-methylanilino)-N-[(3S)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxy-N-methylanilino)-N-[(3S)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 94819772 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | 2-(3,4-dimethoxy-N-methylanilino)-N-[(3S)-2-oxoazepan-3-yl]acetamide |
| SMILES | COc1ccc(N(C)CC(=O)N[C@H]2CCCCNC2=O)cc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-20(12-7-8-14(23-2)15(10-12)24-3)11-16(21)19-13-6-4-5-9-18-17(13)22/h7-8,10,13H,4-6,9,11H2,1-3H3,(H,18,22)(H,19,21)/t13-/m0/s1 |
| InChIKey | RZFBIPWHISGQMR-ZDUSSCGKSA-N |
| XLogP | 0.92 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|