C12H18O7 — CID 10378626
[(2R,3S,4R)-4-acetyloxy-3-(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10378626) has the molecular formula C12H18O7 and a molecular weight of 274.27 g/mol. Its IUPAC name is [(2R,3S,4R)-4-acetyloxy-3-(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R)-4-acetyloxy-3-(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10378626 |
| Molecular Formula | C12H18O7 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [(2R,3S,4R)-4-acetyloxy-3-(methoxymethoxy)-3,4-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | COCO[C@H]1[C@H](OC(C)=O)C=CO[C@@H]1COC(C)=O |
| InChI | InChI=1S/C12H18O7/c1-8(13)17-6-11-12(18-7-15-3)10(4-5-16-11)19-9(2)14/h4-5,10-12H,6-7H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | XMQCYNLGPAVPCR-UTUOFQBUSA-N |
| XLogP | 0.38 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|