C14H25NO2 — CID 103787562
4-[4-(furan-2-yl)butan-2-ylamino]-3,3-dimethylbutan-1-ol (PubChem CID 103787562) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-[4-(furan-2-yl)butan-2-ylamino]-3,3-dimethylbutan-1-ol.
| Compound Name | 4-[4-(furan-2-yl)butan-2-ylamino]-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 103787562 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-[4-(furan-2-yl)butan-2-ylamino]-3,3-dimethylbutan-1-ol |
| SMILES | CC(CCc1ccco1)NCC(C)(C)CCO |
| InChI | InChI=1S/C14H25NO2/c1-12(6-7-13-5-4-10-17-13)15-11-14(2,3)8-9-16/h4-5,10,12,15-16H,6-9,11H2,1-3H3 |
| InChIKey | QARRMCPIAAPQJW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |