C13H21NO2 — CID 66004063
3-[[4-(furan-2-yl)butan-2-ylamino]methyl]cyclobutan-1-ol (PubChem CID 66004063) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 3-[[4-(furan-2-yl)butan-2-ylamino]methyl]cyclobutan-1-ol.
| Compound Name | 3-[[4-(furan-2-yl)butan-2-ylamino]methyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 66004063 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 3-[[4-(furan-2-yl)butan-2-ylamino]methyl]cyclobutan-1-ol |
| SMILES | CC(CCc1ccco1)NCC1CC(O)C1 |
| InChI | InChI=1S/C13H21NO2/c1-10(4-5-13-3-2-6-16-13)14-9-11-7-12(15)8-11/h2-3,6,10-12,14-15H,4-5,7-9H2,1H3 |
| InChIKey | HEUKHHNMAUIMAL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |