C8H17F2NO — CID 103787947
1,1-difluoro-3-(pentan-2-ylamino)propan-2-ol (PubChem CID 103787947) has the molecular formula C8H17F2NO and a molecular weight of 181.23 g/mol. Its IUPAC name is 1,1-difluoro-3-(pentan-2-ylamino)propan-2-ol.
| Compound Name | 1,1-difluoro-3-(pentan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 103787947 |
| Molecular Formula | C8H17F2NO |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | 1,1-difluoro-3-(pentan-2-ylamino)propan-2-ol |
| SMILES | CCCC(C)NCC(O)C(F)F |
| InChI | InChI=1S/C8H17F2NO/c1-3-4-6(2)11-5-7(12)8(9)10/h6-8,11-12H,3-5H2,1-2H3 |
| InChIKey | JXCJHZRLFJVWCO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |