C14H17F2N3O — CID 103787996
1,1-difluoro-3-[1-(4-imidazol-1-ylphenyl)ethylamino]propan-2-ol (PubChem CID 103787996) has the molecular formula C14H17F2N3O and a molecular weight of 281.31 g/mol. Its IUPAC name is 1,1-difluoro-3-[1-(4-imidazol-1-ylphenyl)ethylamino]propan-2-ol.
| Compound Name | 1,1-difluoro-3-[1-(4-imidazol-1-ylphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 103787996 |
| Molecular Formula | C14H17F2N3O |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1,1-difluoro-3-[1-(4-imidazol-1-ylphenyl)ethylamino]propan-2-ol |
| SMILES | CC(NCC(O)C(F)F)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C14H17F2N3O/c1-10(18-8-13(20)14(15)16)11-2-4-12(5-3-11)19-7-6-17-9-19/h2-7,9-10,13-14,18,20H,8H2,1H3 |
| InChIKey | ONPPZHFPDMOGLW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |