C15H17ClINO3 — CID 103790760
2-[1-[(5-chloro-2-iodobenzoyl)amino]cyclohexyl]acetic acid (PubChem CID 103790760) has the molecular formula C15H17ClINO3 and a molecular weight of 421.66 g/mol. Its IUPAC name is 2-[1-[(5-chloro-2-iodobenzoyl)amino]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[(5-chloro-2-iodobenzoyl)amino]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 103790760 |
| Molecular Formula | C15H17ClINO3 |
| Molecular Weight | 421.66 g/mol |
| Exact Mass | 420.99 |
| IUPAC Name | 2-[1-[(5-chloro-2-iodobenzoyl)amino]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc(Cl)ccc2I)CCCCC1 |
| InChI | InChI=1S/C15H17ClINO3/c16-10-4-5-12(17)11(8-10)14(21)18-15(9-13(19)20)6-2-1-3-7-15/h4-5,8H,1-3,6-7,9H2,(H,18,21)(H,19,20) |
| InChIKey | AJXSFTKTJFZQEQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|