C13H13IN2O5 — CID 103790767
2-[1-[(2-iodo-5-nitrobenzoyl)amino]cyclobutyl]acetic acid (PubChem CID 103790767) has the molecular formula C13H13IN2O5 and a molecular weight of 404.16 g/mol. Its IUPAC name is 2-[1-[(2-iodo-5-nitrobenzoyl)amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[(2-iodo-5-nitrobenzoyl)amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 103790767 |
| Molecular Formula | C13H13IN2O5 |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | 2-[1-[(2-iodo-5-nitrobenzoyl)amino]cyclobutyl]acetic acid |
| SMILES | O=C(O)CC1(NC(=O)c2cc([N+](=O)[O-])ccc2I)CCC1 |
| InChI | InChI=1S/C13H13IN2O5/c14-10-3-2-8(16(20)21)6-9(10)12(19)15-13(4-1-5-13)7-11(17)18/h2-3,6H,1,4-5,7H2,(H,15,19)(H,17,18) |
| InChIKey | RPXSFBLQXPKEKS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|