C10H19NO3S — CID 103791212
(2R)-2-[(2-ethylsulfanyl-3-methylbutanoyl)amino]propanoic acid (PubChem CID 103791212) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is (2R)-2-[(2-ethylsulfanyl-3-methylbutanoyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(2-ethylsulfanyl-3-methylbutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 103791212 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2R)-2-[(2-ethylsulfanyl-3-methylbutanoyl)amino]propanoic acid |
| SMILES | CCSC(C(=O)N[C@H](C)C(=O)O)C(C)C |
| InChI | InChI=1S/C10H19NO3S/c1-5-15-8(6(2)3)9(12)11-7(4)10(13)14/h6-8H,5H2,1-4H3,(H,11,12)(H,13,14)/t7-,8?/m1/s1 |
| InChIKey | SITMRCVVBVGUNT-GVHYBUMESA-N |
| XLogP | 1.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |