C15H14FNO3S — CID 103791536
4-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-2-fluorobenzoic acid (PubChem CID 103791536) has the molecular formula C15H14FNO3S and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-2-fluorobenzoic acid.
| Compound Name | 4-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 103791536 |
| Molecular Formula | C15H14FNO3S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-[(4-ethyl-5-methylthiophene-2-carbonyl)amino]-2-fluorobenzoic acid |
| SMILES | CCc1cc(C(=O)Nc2ccc(C(=O)O)c(F)c2)sc1C |
| InChI | InChI=1S/C15H14FNO3S/c1-3-9-6-13(21-8(9)2)14(18)17-10-4-5-11(15(19)20)12(16)7-10/h4-7H,3H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | IVMOPQCOAZQPOM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |