C14H18BrFN2O — CID 103792650
1-[2-[(2-bromo-4-fluorophenyl)methylamino]propyl]pyrrolidin-2-one (PubChem CID 103792650) has the molecular formula C14H18BrFN2O and a molecular weight of 329.21 g/mol. Its IUPAC name is 1-[2-[(2-bromo-4-fluorophenyl)methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[2-[(2-bromo-4-fluorophenyl)methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 103792650 |
| Molecular Formula | C14H18BrFN2O |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | 1-[2-[(2-bromo-4-fluorophenyl)methylamino]propyl]pyrrolidin-2-one |
| SMILES | CC(CN1CCCC1=O)NCc1ccc(F)cc1Br |
| InChI | InChI=1S/C14H18BrFN2O/c1-10(9-18-6-2-3-14(18)19)17-8-11-4-5-12(16)7-13(11)15/h4-5,7,10,17H,2-3,6,8-9H2,1H3 |
| InChIKey | MJGLLFNHAPLIRO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |