C16H14FNOS — CID 10379313
6-(3-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione (PubChem CID 10379313) has the molecular formula C16H14FNOS and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-(3-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione.
| Compound Name | 6-(3-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 10379313 |
| Molecular Formula | C16H14FNOS |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 6-(3-fluorophenyl)-4,4-dimethyl-1H-3,1-benzoxazine-2-thione |
| SMILES | CC1(C)OC(=S)Nc2ccc(-c3cccc(F)c3)cc21 |
| InChI | InChI=1S/C16H14FNOS/c1-16(2)13-9-11(10-4-3-5-12(17)8-10)6-7-14(13)18-15(20)19-16/h3-9H,1-2H3,(H,18,20) |
| InChIKey | JKKKYMAGXVPMSE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|