C18H16ClNOS — CID 10449284
6-(3-chlorophenyl)-4-methyl-4-prop-2-enyl-1H-3,1-benzoxazine-2-thione (PubChem CID 10449284) has the molecular formula C18H16ClNOS and a molecular weight of 329.85 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-4-methyl-4-prop-2-enyl-1H-3,1-benzoxazine-2-thione.
| Compound Name | 6-(3-chlorophenyl)-4-methyl-4-prop-2-enyl-1H-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 10449284 |
| Molecular Formula | C18H16ClNOS |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 6-(3-chlorophenyl)-4-methyl-4-prop-2-enyl-1H-3,1-benzoxazine-2-thione |
| SMILES | C=CCC1(C)OC(=S)Nc2ccc(-c3cccc(Cl)c3)cc21 |
| InChI | InChI=1S/C18H16ClNOS/c1-3-9-18(2)15-11-13(12-5-4-6-14(19)10-12)7-8-16(15)20-17(22)21-18/h3-8,10-11H,1,9H2,2H3,(H,20,22) |
| InChIKey | UXICZAAUDQWRQA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|