C12H20N2O — CID 103793569
1-propyl-3-(3-tricyclo[3.2.1.02,4]octanyl)urea (PubChem CID 103793569) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-propyl-3-(3-tricyclo[3.2.1.02,4]octanyl)urea.
| Compound Name | 1-propyl-3-(3-tricyclo[3.2.1.02,4]octanyl)urea |
|---|---|
| PubChem CID | 103793569 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-propyl-3-(3-tricyclo[3.2.1.02,4]octanyl)urea |
| SMILES | CCCNC(=O)NC1C2C3CCC(C3)C12 |
| InChI | InChI=1S/C12H20N2O/c1-2-5-13-12(15)14-11-9-7-3-4-8(6-7)10(9)11/h7-11H,2-6H2,1H3,(H2,13,14,15) |
| InChIKey | AALDMRUSQURBAH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |